C24H30O6 — CID 67710681
(8R,9S,10R,13S,14S,17R)-6-(acetyloxymethyl)-17-hydroxy-10,13-dimethyl-16-methylidene-3-oxo-1,2,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-17-carboxylic acid (PubChem CID 67710681) has the molecular formula C24H30O6 and a molecular weight of 414.50 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S,17R)-6-(acetyloxymethyl)-17-hydroxy-10,13-dimethyl-16-methylidene-3-oxo-1,2,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-17-carboxylic acid.
| Compound Name | (8R,9S,10R,13S,14S,17R)-6-(acetyloxymethyl)-17-hydroxy-10,13-dimethyl-16-methylidene-3-oxo-1,2,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-17-carboxylic acid |
|---|---|
| PubChem CID | 67710681 |
| Molecular Formula | C24H30O6 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | (8R,9S,10R,13S,14S,17R)-6-(acetyloxymethyl)-17-hydroxy-10,13-dimethyl-16-methylidene-3-oxo-1,2,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-17-carboxylic acid |
| SMILES | C=C1C[C@H]2[C@@H]3C=C(COC(C)=O)C4=CC(=O)CC[C@]4(C)[C@H]3CC[C@]2(C)[C@@]1(O)C(=O)O |
| InChI | InChI=1S/C24H30O6/c1-13-9-20-17-10-15(12-30-14(2)25)19-11-16(26)5-7-22(19,3)18(17)6-8-23(20,4)24(13,29)21(27)28/h10-11,17-18,20,29H,1,5-9,12H2,2-4H3,(H,27,28)/t17-,18+,20+,22-,23+,24+/m1/s1 |
| InChIKey | XKNYIHRVTDWDQN-HGTWGMFFSA-N |
| XLogP | 3.21 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|