C22H26O4 — CID 67710664
(8R,9S,10R,13S,14S,17R)-17-hydroxy-6,10,13-trimethyl-16-methylidene-3-oxo-8,9,11,12,14,15-hexahydrocyclopenta[a]phenanthrene-17-carboxylic acid (PubChem CID 67710664) has the molecular formula C22H26O4 and a molecular weight of 354.45 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S,17R)-17-hydroxy-6,10,13-trimethyl-16-methylidene-3-oxo-8,9,11,12,14,15-hexahydrocyclopenta[a]phenanthrene-17-carboxylic acid.
| Compound Name | (8R,9S,10R,13S,14S,17R)-17-hydroxy-6,10,13-trimethyl-16-methylidene-3-oxo-8,9,11,12,14,15-hexahydrocyclopenta[a]phenanthrene-17-carboxylic acid |
|---|---|
| PubChem CID | 67710664 |
| Molecular Formula | C22H26O4 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | (8R,9S,10R,13S,14S,17R)-17-hydroxy-6,10,13-trimethyl-16-methylidene-3-oxo-8,9,11,12,14,15-hexahydrocyclopenta[a]phenanthrene-17-carboxylic acid |
| SMILES | C=C1C[C@H]2[C@@H]3C=C(C)C4=CC(=O)C=C[C@]4(C)[C@H]3CC[C@]2(C)[C@@]1(O)C(=O)O |
| InChI | InChI=1S/C22H26O4/c1-12-9-15-16(20(3)7-5-14(23)11-17(12)20)6-8-21(4)18(15)10-13(2)22(21,26)19(24)25/h5,7,9,11,15-16,18,26H,2,6,8,10H2,1,3-4H3,(H,24,25)/t15-,16+,18+,20-,21+,22+/m1/s1 |
| InChIKey | IQMLKAMSPMJOLT-COOGFRGXSA-N |
| XLogP | 3.44 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|