C26H32O6 — CID 90679400
[(8R,9S,10R,13S,14S,17R)-17-acetyl-17-acetyloxy-10,13-dimethyl-16-methylidene-3-oxo-1,2,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-6-yl] acetate (PubChem CID 90679400) has the molecular formula C26H32O6 and a molecular weight of 440.54 g/mol. Its IUPAC name is [(8R,9S,10R,13S,14S,17R)-17-acetyl-17-acetyloxy-10,13-dimethyl-16-methylidene-3-oxo-1,2,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-6-yl] acetate.
| Compound Name | [(8R,9S,10R,13S,14S,17R)-17-acetyl-17-acetyloxy-10,13-dimethyl-16-methylidene-3-oxo-1,2,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-6-yl] acetate |
|---|---|
| PubChem CID | 90679400 |
| Molecular Formula | C26H32O6 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | [(8R,9S,10R,13S,14S,17R)-17-acetyl-17-acetyloxy-10,13-dimethyl-16-methylidene-3-oxo-1,2,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-6-yl] acetate |
| SMILES | C=C1C[C@H]2[C@@H]3C=C(OC(C)=O)C4=CC(=O)CC[C@]4(C)[C@H]3CC[C@]2(C)[C@@]1(OC(C)=O)C(C)=O |
| InChI | InChI=1S/C26H32O6/c1-14-11-21-19-13-23(31-16(3)28)22-12-18(30)7-9-24(22,5)20(19)8-10-25(21,6)26(14,15(2)27)32-17(4)29/h12-13,19-21H,1,7-11H2,2-6H3/t19-,20+,21+,24-,25+,26+/m1/s1 |
| InChIKey | YKXSEFIPJPYKHU-INBGZVBYSA-N |
| XLogP | 4.24 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|