C26H42O7 — CID 163012287
[3-(acetyloxymethyl)-5-[5-(acetyloxymethyl)-3-hydroxy-1,2,4a-trimethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]pentyl] acetate (PubChem CID 163012287) has the molecular formula C26H42O7 and a molecular weight of 466.62 g/mol. Its IUPAC name is [3-(acetyloxymethyl)-5-[5-(acetyloxymethyl)-3-hydroxy-1,2,4a-trimethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]pentyl] acetate.
| Compound Name | [3-(acetyloxymethyl)-5-[5-(acetyloxymethyl)-3-hydroxy-1,2,4a-trimethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]pentyl] acetate |
|---|---|
| PubChem CID | 163012287 |
| Molecular Formula | C26H42O7 |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.29 |
| IUPAC Name | [3-(acetyloxymethyl)-5-[5-(acetyloxymethyl)-3-hydroxy-1,2,4a-trimethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]pentyl] acetate |
| SMILES | CC(=O)OCCC(CCC1(C)C(C)C(O)CC2(C)C(COC(C)=O)=CCCC21)COC(C)=O |
| InChI | InChI=1S/C26H42O7/c1-17-23(30)14-26(6)22(16-33-20(4)29)8-7-9-24(26)25(17,5)12-10-21(15-32-19(3)28)11-13-31-18(2)27/h8,17,21,23-24,30H,7,9-16H2,1-6H3 |
| InChIKey | VZXCGGGUOOICDE-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|