C21H36O4 — CID 163070115
(2R,3S,4R,4aR,8aR)-8-(hydroxymethyl)-4-[2-[(3S,5S)-5-methoxyoxolan-3-yl]ethyl]-3,4,8a-trimethyl-1,2,3,4a,5,6-hexahydronaphthalen-2-ol (PubChem CID 163070115) has the molecular formula C21H36O4 and a molecular weight of 352.52 g/mol. Its IUPAC name is (2R,3S,4R,4aR,8aR)-8-(hydroxymethyl)-4-[2-[(3S,5S)-5-methoxyoxolan-3-yl]ethyl]-3,4,8a-trimethyl-1,2,3,4a,5,6-hexahydronaphthalen-2-ol.
| Compound Name | (2R,3S,4R,4aR,8aR)-8-(hydroxymethyl)-4-[2-[(3S,5S)-5-methoxyoxolan-3-yl]ethyl]-3,4,8a-trimethyl-1,2,3,4a,5,6-hexahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 163070115 |
| Molecular Formula | C21H36O4 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.26 |
| IUPAC Name | (2R,3S,4R,4aR,8aR)-8-(hydroxymethyl)-4-[2-[(3S,5S)-5-methoxyoxolan-3-yl]ethyl]-3,4,8a-trimethyl-1,2,3,4a,5,6-hexahydronaphthalen-2-ol |
| SMILES | CO[C@@H]1C[C@H](CC[C@@]2(C)[C@H](C)[C@H](O)C[C@@]3(C)C(CO)=CCC[C@H]23)CO1 |
| InChI | InChI=1S/C21H36O4/c1-14-17(23)11-21(3)16(12-22)6-5-7-18(21)20(14,2)9-8-15-10-19(24-4)25-13-15/h6,14-15,17-19,22-23H,5,7-13H2,1-4H3/t14-,15+,17-,18-,19+,20+,21+/m1/s1 |
| InChIKey | GOCXWVDTBKRQRK-XYLWGEAYSA-N |
| XLogP | 3.52 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|