C24H40O5 — CID 163029409
[3-(acetyloxymethyl)-5-[5-(hydroxymethyl)-1,2,4a-trimethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]pentyl] acetate (PubChem CID 163029409) has the molecular formula C24H40O5 and a molecular weight of 408.58 g/mol. Its IUPAC name is [3-(acetyloxymethyl)-5-[5-(hydroxymethyl)-1,2,4a-trimethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]pentyl] acetate.
| Compound Name | [3-(acetyloxymethyl)-5-[5-(hydroxymethyl)-1,2,4a-trimethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]pentyl] acetate |
|---|---|
| PubChem CID | 163029409 |
| Molecular Formula | C24H40O5 |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.29 |
| IUPAC Name | [3-(acetyloxymethyl)-5-[5-(hydroxymethyl)-1,2,4a-trimethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]pentyl] acetate |
| SMILES | CC(=O)OCCC(CCC1(C)C(C)CCC2(C)C(CO)=CCCC21)COC(C)=O |
| InChI | InChI=1S/C24H40O5/c1-17-9-12-24(5)21(15-25)7-6-8-22(24)23(17,4)13-10-20(16-29-19(3)27)11-14-28-18(2)26/h7,17,20,22,25H,6,8-16H2,1-5H3 |
| InChIKey | SLOVHNWACCJKPR-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|