C29H46O8 — CID 124853458
4-[[(4aR,5R,6R,8aR)-8a-(hydroxymethyl)-5-[(3S)-5-hydroxy-3-[[(Z)-2-methylbut-2-enoyl]oxymethyl]pentyl]-5,6-dimethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]methoxy]-4-oxobutanoic acid (PubChem CID 124853458) has the molecular formula C29H46O8 and a molecular weight of 522.68 g/mol. Its IUPAC name is 4-[[(4aR,5R,6R,8aR)-8a-(hydroxymethyl)-5-[(3S)-5-hydroxy-3-[[(Z)-2-methylbut-2-enoyl]oxymethyl]pentyl]-5,6-dimethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]methoxy]-4-oxobutanoic acid.
| Compound Name | 4-[[(4aR,5R,6R,8aR)-8a-(hydroxymethyl)-5-[(3S)-5-hydroxy-3-[[(Z)-2-methylbut-2-enoyl]oxymethyl]pentyl]-5,6-dimethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]methoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 124853458 |
| Molecular Formula | C29H46O8 |
| Molecular Weight | 522.68 g/mol |
| Exact Mass | 522.32 |
| IUPAC Name | 4-[[(4aR,5R,6R,8aR)-8a-(hydroxymethyl)-5-[(3S)-5-hydroxy-3-[[(Z)-2-methylbut-2-enoyl]oxymethyl]pentyl]-5,6-dimethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]methoxy]-4-oxobutanoic acid |
| SMILES | C/C=C(/C)C(=O)OCC(CCO)CC[C@]1(C)[C@H](C)CC[C@]2(CO)C(COC(=O)CCC(=O)O)=CCC[C@@H]21 |
| InChI | InChI=1S/C29H46O8/c1-5-20(2)27(35)37-17-22(13-16-30)12-14-28(4)21(3)11-15-29(19-31)23(7-6-8-24(28)29)18-36-26(34)10-9-25(32)33/h5,7,21-22,24,30-31H,6,8-19H2,1-4H3,(H,32,33)/b20-5-/t21-,22?,24-,28-,29+/m1/s1 |
| InChIKey | OVBBFGXDDIFFMB-AVYCYMKKSA-N |
| XLogP | 4.43 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.68 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|