C15H22O3 — CID 38364106
(3aS,8aR)-3-(2-hydroxypropan-2-yl)-8a-methyl-3a,4,5,8-tetrahydro-1H-azulene-6-carboxylic acid (PubChem CID 38364106) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (3aS,8aR)-3-(2-hydroxypropan-2-yl)-8a-methyl-3a,4,5,8-tetrahydro-1H-azulene-6-carboxylic acid.
| Compound Name | (3aS,8aR)-3-(2-hydroxypropan-2-yl)-8a-methyl-3a,4,5,8-tetrahydro-1H-azulene-6-carboxylic acid |
|---|---|
| PubChem CID | 38364106 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (3aS,8aR)-3-(2-hydroxypropan-2-yl)-8a-methyl-3a,4,5,8-tetrahydro-1H-azulene-6-carboxylic acid |
| SMILES | CC(C)(O)C1=CC[C@]2(C)CC=C(C(=O)O)CC[C@H]12 |
| InChI | InChI=1S/C15H22O3/c1-14(2,18)11-7-9-15(3)8-6-10(13(16)17)4-5-12(11)15/h6-7,12,18H,4-5,8-9H2,1-3H3,(H,16,17)/t12-,15+/m1/s1 |
| InChIKey | FRQNMWRDOPEOTC-DOMZBBRYSA-N |
| XLogP | 2.90 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|