C15H24O3 — CID 28809
4-(6-methyl-4-oxoheptan-2-yl)cyclohexene-1-carboxylic acid (PubChem CID 28809) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is 4-(6-methyl-4-oxoheptan-2-yl)cyclohexene-1-carboxylic acid.
| Compound Name | 4-(6-methyl-4-oxoheptan-2-yl)cyclohexene-1-carboxylic acid |
|---|---|
| PubChem CID | 28809 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 4-(6-methyl-4-oxoheptan-2-yl)cyclohexene-1-carboxylic acid |
| SMILES | CC(C)CC(=O)CC(C)C1CC=C(C(=O)O)CC1 |
| InChI | InChI=1S/C15H24O3/c1-10(2)8-14(16)9-11(3)12-4-6-13(7-5-12)15(17)18/h6,10-12H,4-5,7-9H2,1-3H3,(H,17,18) |
| InChIKey | XPXCWUPURKUWHC-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |