C11H19I — CID 102318246
cis-(1R,2R)-2-(iodomethyl)-1-methyl-1-(4-methylpent-3-enyl)cyclopropane (PubChem CID 102318246) has the molecular formula C11H19I and a molecular weight of 278.18 g/mol. Its IUPAC name is cis-(1R,2R)-2-(iodomethyl)-1-methyl-1-(4-methylpent-3-enyl)cyclopropane.
| Compound Name | cis-(1R,2R)-2-(iodomethyl)-1-methyl-1-(4-methylpent-3-enyl)cyclopropane |
|---|---|
| PubChem CID | 102318246 |
| Molecular Formula | C11H19I |
| Molecular Weight | 278.18 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | cis-(1R,2R)-2-(iodomethyl)-1-methyl-1-(4-methylpent-3-enyl)cyclopropane |
| SMILES | CC(C)=CCC[C@]1(C)C[C@H]1CI |
| InChI | InChI=1S/C11H19I/c1-9(2)5-4-6-11(3)7-10(11)8-12/h5,10H,4,6-8H2,1-3H3/t10-,11+/m0/s1 |
| InChIKey | KMNPQWDWULWRFV-WDEREUQCSA-N |
| XLogP | 4.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.18 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|