C14H24O3S — CID 171952164
3-(4-methylpent-3-enyl)-9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-ol (PubChem CID 171952164) has the molecular formula C14H24O3S and a molecular weight of 272.41 g/mol. Its IUPAC name is 3-(4-methylpent-3-enyl)-9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-ol.
| Compound Name | 3-(4-methylpent-3-enyl)-9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-ol |
|---|---|
| PubChem CID | 171952164 |
| Molecular Formula | C14H24O3S |
| Molecular Weight | 272.41 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 3-(4-methylpent-3-enyl)-9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-ol |
| SMILES | CC(C)=CCCC1(O)CC2CCCC(C1)S2(=O)=O |
| InChI | InChI=1S/C14H24O3S/c1-11(2)5-4-8-14(15)9-12-6-3-7-13(10-14)18(12,16)17/h5,12-13,15H,3-4,6-10H2,1-2H3 |
| InChIKey | UQTOZEYKWKILQG-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.41 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|