C14H13F5O3S — CID 171957234
8,8-dioxo-3-[(2,3,4,5,6-pentafluorophenyl)methyl]-8λ6-thiabicyclo[3.2.1]octan-3-ol (PubChem CID 171957234) has the molecular formula C14H13F5O3S and a molecular weight of 356.31 g/mol. Its IUPAC name is 8,8-dioxo-3-[(2,3,4,5,6-pentafluorophenyl)methyl]-8λ6-thiabicyclo[3.2.1]octan-3-ol.
| Compound Name | 8,8-dioxo-3-[(2,3,4,5,6-pentafluorophenyl)methyl]-8λ6-thiabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 171957234 |
| Molecular Formula | C14H13F5O3S |
| Molecular Weight | 356.31 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | 8,8-dioxo-3-[(2,3,4,5,6-pentafluorophenyl)methyl]-8λ6-thiabicyclo[3.2.1]octan-3-ol |
| SMILES | O=S1(=O)C2CCC1CC(O)(Cc1c(F)c(F)c(F)c(F)c1F)C2 |
| InChI | InChI=1S/C14H13F5O3S/c15-9-8(10(16)12(18)13(19)11(9)17)5-14(20)3-6-1-2-7(4-14)23(6,21)22/h6-7,20H,1-5H2 |
| InChIKey | ARKQBXJNLFLMAT-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.31 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|