C14H14F4O3S — CID 171955368
9,9-dioxo-3-(2,3,5,6-tetrafluorophenyl)-9λ6-thiabicyclo[3.3.1]nonan-3-ol (PubChem CID 171955368) has the molecular formula C14H14F4O3S and a molecular weight of 338.32 g/mol. Its IUPAC name is 9,9-dioxo-3-(2,3,5,6-tetrafluorophenyl)-9λ6-thiabicyclo[3.3.1]nonan-3-ol.
| Compound Name | 9,9-dioxo-3-(2,3,5,6-tetrafluorophenyl)-9λ6-thiabicyclo[3.3.1]nonan-3-ol |
|---|---|
| PubChem CID | 171955368 |
| Molecular Formula | C14H14F4O3S |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 9,9-dioxo-3-(2,3,5,6-tetrafluorophenyl)-9λ6-thiabicyclo[3.3.1]nonan-3-ol |
| SMILES | O=S1(=O)C2CCCC1CC(O)(c1c(F)c(F)cc(F)c1F)C2 |
| InChI | InChI=1S/C14H14F4O3S/c15-9-4-10(16)13(18)11(12(9)17)14(19)5-7-2-1-3-8(6-14)22(7,20)21/h4,7-8,19H,1-3,5-6H2 |
| InChIKey | SRZKAYZSEOLBPC-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|