C14H16F2O3S — CID 171958541
3-(2,3-difluorophenyl)-9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-ol (PubChem CID 171958541) has the molecular formula C14H16F2O3S and a molecular weight of 302.34 g/mol. Its IUPAC name is 3-(2,3-difluorophenyl)-9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-ol.
| Compound Name | 3-(2,3-difluorophenyl)-9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-ol |
|---|---|
| PubChem CID | 171958541 |
| Molecular Formula | C14H16F2O3S |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 3-(2,3-difluorophenyl)-9,9-dioxo-9λ6-thiabicyclo[3.3.1]nonan-3-ol |
| SMILES | O=S1(=O)C2CCCC1CC(O)(c1cccc(F)c1F)C2 |
| InChI | InChI=1S/C14H16F2O3S/c15-12-6-2-5-11(13(12)16)14(17)7-9-3-1-4-10(8-14)20(9,18)19/h2,5-6,9-10,17H,1,3-4,7-8H2 |
| InChIKey | XINLONRYVAGADA-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |