C14H15F3O3S — CID 171955657
8,8-dioxo-3-[(2,3,6-trifluorophenyl)methyl]-8λ6-thiabicyclo[3.2.1]octan-3-ol (PubChem CID 171955657) has the molecular formula C14H15F3O3S and a molecular weight of 320.33 g/mol. Its IUPAC name is 8,8-dioxo-3-[(2,3,6-trifluorophenyl)methyl]-8λ6-thiabicyclo[3.2.1]octan-3-ol.
| Compound Name | 8,8-dioxo-3-[(2,3,6-trifluorophenyl)methyl]-8λ6-thiabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 171955657 |
| Molecular Formula | C14H15F3O3S |
| Molecular Weight | 320.33 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 8,8-dioxo-3-[(2,3,6-trifluorophenyl)methyl]-8λ6-thiabicyclo[3.2.1]octan-3-ol |
| SMILES | O=S1(=O)C2CCC1CC(O)(Cc1c(F)ccc(F)c1F)C2 |
| InChI | InChI=1S/C14H15F3O3S/c15-11-3-4-12(16)13(17)10(11)7-14(18)5-8-1-2-9(6-14)21(8,19)20/h3-4,8-9,18H,1-2,5-7H2 |
| InChIKey | ABRIGZGVBXWOOF-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.33 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|