C11H18O3S — CID 171953211
9,9-dioxo-3-[(Z)-prop-1-enyl]-9λ6-thiabicyclo[3.3.1]nonan-3-ol (PubChem CID 171953211) has the molecular formula C11H18O3S and a molecular weight of 230.33 g/mol. Its IUPAC name is 9,9-dioxo-3-[(Z)-prop-1-enyl]-9λ6-thiabicyclo[3.3.1]nonan-3-ol.
| Compound Name | 9,9-dioxo-3-[(Z)-prop-1-enyl]-9λ6-thiabicyclo[3.3.1]nonan-3-ol |
|---|---|
| PubChem CID | 171953211 |
| Molecular Formula | C11H18O3S |
| Molecular Weight | 230.33 g/mol |
| Exact Mass | 230.10 |
| IUPAC Name | 9,9-dioxo-3-[(Z)-prop-1-enyl]-9λ6-thiabicyclo[3.3.1]nonan-3-ol |
| SMILES | C/C=C\C1(O)CC2CCCC(C1)S2(=O)=O |
| InChI | InChI=1S/C11H18O3S/c1-2-6-11(12)7-9-4-3-5-10(8-11)15(9,13)14/h2,6,9-10,12H,3-5,7-8H2,1H3/b6-2- |
| InChIKey | YZWTXDYXUDDKFN-KXFIGUGUSA-N |
| XLogP | 1.42 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.33 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|