C19H33NO — CID 76600034
N-tert-butyl-N-[[2-methyl-2-(4-methylpent-3-enyl)cyclopropyl]methyl]but-2-enamide (PubChem CID 76600034) has the molecular formula C19H33NO and a molecular weight of 291.48 g/mol. Its IUPAC name is N-tert-butyl-N-[[2-methyl-2-(4-methylpent-3-enyl)cyclopropyl]methyl]but-2-enamide.
| Compound Name | N-tert-butyl-N-[[2-methyl-2-(4-methylpent-3-enyl)cyclopropyl]methyl]but-2-enamide |
|---|---|
| PubChem CID | 76600034 |
| Molecular Formula | C19H33NO |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.26 |
| IUPAC Name | N-tert-butyl-N-[[2-methyl-2-(4-methylpent-3-enyl)cyclopropyl]methyl]but-2-enamide |
| SMILES | CC=CC(=O)N(CC1CC1(C)CCC=C(C)C)C(C)(C)C |
| InChI | InChI=1S/C19H33NO/c1-8-10-17(21)20(18(4,5)6)14-16-13-19(16,7)12-9-11-15(2)3/h8,10-11,16H,9,12-14H2,1-7H3 |
| InChIKey | QDTKJFVAVKUZLE-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|