C18H33NO — CID 76599958
N-tert-butyl-N-(3,7-dimethylocta-2,6-dienyl)butanamide (PubChem CID 76599958) has the molecular formula C18H33NO and a molecular weight of 279.47 g/mol. Its IUPAC name is N-tert-butyl-N-(3,7-dimethylocta-2,6-dienyl)butanamide.
| Compound Name | N-tert-butyl-N-(3,7-dimethylocta-2,6-dienyl)butanamide |
|---|---|
| PubChem CID | 76599958 |
| Molecular Formula | C18H33NO |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.26 |
| IUPAC Name | N-tert-butyl-N-(3,7-dimethylocta-2,6-dienyl)butanamide |
| SMILES | CCCC(=O)N(CC=C(C)CCC=C(C)C)C(C)(C)C |
| InChI | InChI=1S/C18H33NO/c1-8-10-17(20)19(18(5,6)7)14-13-16(4)12-9-11-15(2)3/h11,13H,8-10,12,14H2,1-7H3 |
| InChIKey | LQVHBNJGSZKLDX-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|