C23H43N — CID 145357021
(2E)-N-[(2E)-3,7-dimethylocta-2,6-dienyl]-N,3,7-trimethylocta-2,6-dien-1-amine;ethane (PubChem CID 145357021) has the molecular formula C23H43N and a molecular weight of 333.60 g/mol. Its IUPAC name is (2E)-N-[(2E)-3,7-dimethylocta-2,6-dienyl]-N,3,7-trimethylocta-2,6-dien-1-amine;ethane.
| Compound Name | (2E)-N-[(2E)-3,7-dimethylocta-2,6-dienyl]-N,3,7-trimethylocta-2,6-dien-1-amine;ethane |
|---|---|
| PubChem CID | 145357021 |
| Molecular Formula | C23H43N |
| Molecular Weight | 333.60 g/mol |
| Exact Mass | 333.34 |
| IUPAC Name | (2E)-N-[(2E)-3,7-dimethylocta-2,6-dienyl]-N,3,7-trimethylocta-2,6-dien-1-amine;ethane |
| SMILES | CC.CC(C)=CCC/C(C)=C/CN(C)C/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C21H37N.C2H6/c1-18(2)10-8-12-20(5)14-16-22(7)17-15-21(6)13-9-11-19(3)4;1-2/h10-11,14-15H,8-9,12-13,16-17H2,1-7H3;1-2H3/b20-14+,21-15+; |
| InChIKey | NJYITJVHWVWUQO-JICTWDTMSA-N |
| XLogP | 7.33 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.60 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|