C26H41NO5 — CID 18434097
(E)-but-2-enedioic acid;(9E,13E)-2,9,13-trimethyl-15-[methyl(prop-2-enyl)amino]pentadeca-2,9,13-trien-6-one (PubChem CID 18434097) has the molecular formula C26H41NO5 and a molecular weight of 447.62 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;(9E,13E)-2,9,13-trimethyl-15-[methyl(prop-2-enyl)amino]pentadeca-2,9,13-trien-6-one.
| Compound Name | (E)-but-2-enedioic acid;(9E,13E)-2,9,13-trimethyl-15-[methyl(prop-2-enyl)amino]pentadeca-2,9,13-trien-6-one |
|---|---|
| PubChem CID | 18434097 |
| Molecular Formula | C26H41NO5 |
| Molecular Weight | 447.62 g/mol |
| Exact Mass | 447.30 |
| IUPAC Name | (E)-but-2-enedioic acid;(9E,13E)-2,9,13-trimethyl-15-[methyl(prop-2-enyl)amino]pentadeca-2,9,13-trien-6-one |
| SMILES | C=CCN(C)C/C=C(\C)CC/C=C(\C)CCC(=O)CCC=C(C)C.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C22H37NO.C4H4O4/c1-7-17-23(6)18-16-21(5)12-9-11-20(4)14-15-22(24)13-8-10-19(2)3;5-3(6)1-2-4(7)8/h7,10-11,16H,1,8-9,12-15,17-18H2,2-6H3;1-2H,(H,5,6)(H,7,8)/b20-11+,21-16+;2-1+ |
| InChIKey | UDEUAZDCVULOIO-MFSRGIEASA-N |
| XLogP | 5.58 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.62 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|