C18H33NO — CID 76600040
N-(3,7-dimethylocta-2,6-dienyl)-N-(2-methylpropyl)butanamide (PubChem CID 76600040) has the molecular formula C18H33NO and a molecular weight of 279.47 g/mol. Its IUPAC name is N-(3,7-dimethylocta-2,6-dienyl)-N-(2-methylpropyl)butanamide.
| Compound Name | N-(3,7-dimethylocta-2,6-dienyl)-N-(2-methylpropyl)butanamide |
|---|---|
| PubChem CID | 76600040 |
| Molecular Formula | C18H33NO |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.26 |
| IUPAC Name | N-(3,7-dimethylocta-2,6-dienyl)-N-(2-methylpropyl)butanamide |
| SMILES | CCCC(=O)N(CC=C(C)CCC=C(C)C)CC(C)C |
| InChI | InChI=1S/C18H33NO/c1-7-9-18(20)19(14-16(4)5)13-12-17(6)11-8-10-15(2)3/h10,12,16H,7-9,11,13-14H2,1-6H3 |
| InChIKey | ZBBLGSZCBKISIU-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|