C18H33N — CID 138519061
(2E)-3,7-dimethyl-N-(3-methylbutyl)-N-prop-2-enylocta-2,6-dien-1-amine (PubChem CID 138519061) has the molecular formula C18H33N and a molecular weight of 263.47 g/mol. Its IUPAC name is (2E)-3,7-dimethyl-N-(3-methylbutyl)-N-prop-2-enylocta-2,6-dien-1-amine.
| Compound Name | (2E)-3,7-dimethyl-N-(3-methylbutyl)-N-prop-2-enylocta-2,6-dien-1-amine |
|---|---|
| PubChem CID | 138519061 |
| Molecular Formula | C18H33N |
| Molecular Weight | 263.47 g/mol |
| Exact Mass | 263.26 |
| IUPAC Name | (2E)-3,7-dimethyl-N-(3-methylbutyl)-N-prop-2-enylocta-2,6-dien-1-amine |
| SMILES | C=CCN(C/C=C(\C)CCC=C(C)C)CCC(C)C |
| InChI | InChI=1S/C18H33N/c1-7-13-19(14-11-17(4)5)15-12-18(6)10-8-9-16(2)3/h7,9,12,17H,1,8,10-11,13-15H2,2-6H3/b18-12+ |
| InChIKey | BQXMSCOMYUCKQT-LDADJPATSA-N |
| XLogP | 5.21 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.47 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|