C18H29NO — CID 76599938
N-(cyclopropylmethyl)-N-(3,7-dimethylocta-2,6-dienyl)but-2-enamide (PubChem CID 76599938) has the molecular formula C18H29NO and a molecular weight of 275.44 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-N-(3,7-dimethylocta-2,6-dienyl)but-2-enamide.
| Compound Name | N-(cyclopropylmethyl)-N-(3,7-dimethylocta-2,6-dienyl)but-2-enamide |
|---|---|
| PubChem CID | 76599938 |
| Molecular Formula | C18H29NO |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.22 |
| IUPAC Name | N-(cyclopropylmethyl)-N-(3,7-dimethylocta-2,6-dienyl)but-2-enamide |
| SMILES | CC=CC(=O)N(CC=C(C)CCC=C(C)C)CC1CC1 |
| InChI | InChI=1S/C18H29NO/c1-5-7-18(20)19(14-17-10-11-17)13-12-16(4)9-6-8-15(2)3/h5,7-8,12,17H,6,9-11,13-14H2,1-4H3 |
| InChIKey | DQHIBPOWHACNBS-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|