C20H28O6 — CID 10992128
[(3S,3aR,5aS,6R,9R,9aR,9bR)-6,9-dihydroxy-3,5a,9-trimethyl-2-oxo-3a,4,5,6,9a,9b-hexahydrobenzo[g][1]benzofuran-3-yl] 3-methylbut-2-enoate (PubChem CID 10992128) has the molecular formula C20H28O6 and a molecular weight of 364.44 g/mol. Its IUPAC name is [(3S,3aR,5aS,6R,9R,9aR,9bR)-6,9-dihydroxy-3,5a,9-trimethyl-2-oxo-3a,4,5,6,9a,9b-hexahydrobenzo[g][1]benzofuran-3-yl] 3-methylbut-2-enoate.
| Compound Name | [(3S,3aR,5aS,6R,9R,9aR,9bR)-6,9-dihydroxy-3,5a,9-trimethyl-2-oxo-3a,4,5,6,9a,9b-hexahydrobenzo[g][1]benzofuran-3-yl] 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 10992128 |
| Molecular Formula | C20H28O6 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | [(3S,3aR,5aS,6R,9R,9aR,9bR)-6,9-dihydroxy-3,5a,9-trimethyl-2-oxo-3a,4,5,6,9a,9b-hexahydrobenzo[g][1]benzofuran-3-yl] 3-methylbut-2-enoate |
| SMILES | CC(C)=CC(=O)O[C@]1(C)C(=O)O[C@@H]2[C@H]1CC[C@]1(C)[C@H](O)C=C[C@@](C)(O)[C@@H]21 |
| InChI | InChI=1S/C20H28O6/c1-11(2)10-14(22)26-20(5)12-6-8-18(3)13(21)7-9-19(4,24)16(18)15(12)25-17(20)23/h7,9-10,12-13,15-16,21,24H,6,8H2,1-5H3/t12-,13-,15-,16+,18-,19-,20+/m1/s1 |
| InChIKey | LFFOEDOAFGUKGN-IUPPOCIOSA-N |
| XLogP | 1.89 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|