C24H32O9 — CID 163190906
[(3S,3aR,4S,6S,6aS,9S,9aR,9bS)-3,6-diacetyloxy-9-hydroxy-3,6,9-trimethyl-2-oxo-3a,4,5,6a,9a,9b-hexahydroazuleno[4,5-b]furan-4-yl] (E)-2-methylbut-2-enoate (PubChem CID 163190906) has the molecular formula C24H32O9 and a molecular weight of 464.51 g/mol. Its IUPAC name is [(3S,3aR,4S,6S,6aS,9S,9aR,9bS)-3,6-diacetyloxy-9-hydroxy-3,6,9-trimethyl-2-oxo-3a,4,5,6a,9a,9b-hexahydroazuleno[4,5-b]furan-4-yl] (E)-2-methylbut-2-enoate.
| Compound Name | [(3S,3aR,4S,6S,6aS,9S,9aR,9bS)-3,6-diacetyloxy-9-hydroxy-3,6,9-trimethyl-2-oxo-3a,4,5,6a,9a,9b-hexahydroazuleno[4,5-b]furan-4-yl] (E)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 163190906 |
| Molecular Formula | C24H32O9 |
| Molecular Weight | 464.51 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | [(3S,3aR,4S,6S,6aS,9S,9aR,9bS)-3,6-diacetyloxy-9-hydroxy-3,6,9-trimethyl-2-oxo-3a,4,5,6a,9a,9b-hexahydroazuleno[4,5-b]furan-4-yl] (E)-2-methylbut-2-enoate |
| SMILES | C/C=C(\C)C(=O)O[C@H]1C[C@](C)(OC(C)=O)[C@H]2C=C[C@](C)(O)[C@H]2[C@@H]2OC(=O)[C@@](C)(OC(C)=O)[C@@H]21 |
| InChI | InChI=1S/C24H32O9/c1-8-12(2)20(27)30-16-11-23(6,32-13(3)25)15-9-10-22(5,29)17(15)19-18(16)24(7,21(28)31-19)33-14(4)26/h8-10,15-19,29H,11H2,1-7H3/b12-8+/t15-,16-,17+,18+,19-,22-,23-,24-/m0/s1 |
| InChIKey | GZFZYNNSPMGQAY-WOIVLEJJSA-N |
| XLogP | 2.01 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.51 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|