C27H38O9 — CID 163033276
[(3R,3aS,4R,6R,6aR,8S,9bR)-6-acetyloxy-3-hydroxy-3,6,9-trimethyl-8-[(E)-2-methylbut-2-enoyl]oxy-2-oxo-4,5,6a,7,8,9b-hexahydro-3aH-azuleno[4,5-b]furan-4-yl] (2R)-2-methylbutanoate (PubChem CID 163033276) has the molecular formula C27H38O9 and a molecular weight of 506.59 g/mol. Its IUPAC name is [(3R,3aS,4R,6R,6aR,8S,9bR)-6-acetyloxy-3-hydroxy-3,6,9-trimethyl-8-[(E)-2-methylbut-2-enoyl]oxy-2-oxo-4,5,6a,7,8,9b-hexahydro-3aH-azuleno[4,5-b]furan-4-yl] (2R)-2-methylbutanoate.
| Compound Name | [(3R,3aS,4R,6R,6aR,8S,9bR)-6-acetyloxy-3-hydroxy-3,6,9-trimethyl-8-[(E)-2-methylbut-2-enoyl]oxy-2-oxo-4,5,6a,7,8,9b-hexahydro-3aH-azuleno[4,5-b]furan-4-yl] (2R)-2-methylbutanoate |
|---|---|
| PubChem CID | 163033276 |
| Molecular Formula | C27H38O9 |
| Molecular Weight | 506.59 g/mol |
| Exact Mass | 506.25 |
| IUPAC Name | [(3R,3aS,4R,6R,6aR,8S,9bR)-6-acetyloxy-3-hydroxy-3,6,9-trimethyl-8-[(E)-2-methylbut-2-enoyl]oxy-2-oxo-4,5,6a,7,8,9b-hexahydro-3aH-azuleno[4,5-b]furan-4-yl] (2R)-2-methylbutanoate |
| SMILES | C/C=C(\C)C(=O)O[C@H]1C[C@@H]2C(=C1C)[C@@H]1OC(=O)[C@](C)(O)[C@H]1[C@H](OC(=O)[C@H](C)CC)C[C@@]2(C)OC(C)=O |
| InChI | InChI=1S/C27H38O9/c1-9-13(3)23(29)33-18-11-17-20(15(18)5)22-21(27(8,32)25(31)35-22)19(34-24(30)14(4)10-2)12-26(17,7)36-16(6)28/h9,14,17-19,21-22,32H,10-12H2,1-8H3/b13-9+/t14-,17-,18+,19-,21+,22+,26-,27-/m1/s1 |
| InChIKey | BALRXIOODPNKNW-JOAYUGBCSA-N |
| XLogP | 3.18 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.59 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|