C25H35NO2Si — CID 134917452
(9R,13S)-3-[tert-butyl(dimethyl)silyl]oxy-13-methyl-17-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-9-carbonitrile (PubChem CID 134917452) has the molecular formula C25H35NO2Si and a molecular weight of 409.65 g/mol. Its IUPAC name is (9R,13S)-3-[tert-butyl(dimethyl)silyl]oxy-13-methyl-17-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-9-carbonitrile.
| Compound Name | (9R,13S)-3-[tert-butyl(dimethyl)silyl]oxy-13-methyl-17-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-9-carbonitrile |
|---|---|
| PubChem CID | 134917452 |
| Molecular Formula | C25H35NO2Si |
| Molecular Weight | 409.65 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | (9R,13S)-3-[tert-butyl(dimethyl)silyl]oxy-13-methyl-17-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-9-carbonitrile |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc2c(c1)CCC1C3CCC(=O)[C@@]3(C)CC[C@]21C#N |
| InChI | InChI=1S/C25H35NO2Si/c1-23(2,3)29(5,6)28-18-8-10-19-17(15-18)7-9-21-20-11-12-22(27)24(20,4)13-14-25(19,21)16-26/h8,10,15,20-21H,7,9,11-14H2,1-6H3/t20?,21?,24-,25-/m0/s1 |
| InChIKey | ISGRTEHEJWJVNT-WXESENMXSA-N |
| XLogP | 6.17 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.65 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|