C22H34O3Si — CID 66557273
[(1R,2R)-6-[tert-butyl(dimethyl)silyl]oxy-1-methyl-1-prop-2-enyl-3,4-dihydro-2H-naphthalen-2-yl] acetate (PubChem CID 66557273) has the molecular formula C22H34O3Si and a molecular weight of 374.60 g/mol. Its IUPAC name is [(1R,2R)-6-[tert-butyl(dimethyl)silyl]oxy-1-methyl-1-prop-2-enyl-3,4-dihydro-2H-naphthalen-2-yl] acetate.
| Compound Name | [(1R,2R)-6-[tert-butyl(dimethyl)silyl]oxy-1-methyl-1-prop-2-enyl-3,4-dihydro-2H-naphthalen-2-yl] acetate |
|---|---|
| PubChem CID | 66557273 |
| Molecular Formula | C22H34O3Si |
| Molecular Weight | 374.60 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | [(1R,2R)-6-[tert-butyl(dimethyl)silyl]oxy-1-methyl-1-prop-2-enyl-3,4-dihydro-2H-naphthalen-2-yl] acetate |
| SMILES | C=CC[C@]1(C)c2ccc(O[Si](C)(C)C(C)(C)C)cc2CC[C@H]1OC(C)=O |
| InChI | InChI=1S/C22H34O3Si/c1-9-14-22(6)19-12-11-18(25-26(7,8)21(3,4)5)15-17(19)10-13-20(22)24-16(2)23/h9,11-12,15,20H,1,10,13-14H2,2-8H3/t20-,22-/m1/s1 |
| InChIKey | QYQFVUCXLDLYFG-IFMALSPDSA-N |
| XLogP | 5.78 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.60 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|