C17H26O3Si — CID 90282017
2-[4-[tert-butyl(dimethyl)silyl]oxy-2-cyclopropylphenyl]acetic acid (PubChem CID 90282017) has the molecular formula C17H26O3Si and a molecular weight of 306.48 g/mol. Its IUPAC name is 2-[4-[tert-butyl(dimethyl)silyl]oxy-2-cyclopropylphenyl]acetic acid.
| Compound Name | 2-[4-[tert-butyl(dimethyl)silyl]oxy-2-cyclopropylphenyl]acetic acid |
|---|---|
| PubChem CID | 90282017 |
| Molecular Formula | C17H26O3Si |
| Molecular Weight | 306.48 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 2-[4-[tert-butyl(dimethyl)silyl]oxy-2-cyclopropylphenyl]acetic acid |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(CC(=O)O)c(C2CC2)c1 |
| InChI | InChI=1S/C17H26O3Si/c1-17(2,3)21(4,5)20-14-9-8-13(10-16(18)19)15(11-14)12-6-7-12/h8-9,11-12H,6-7,10H2,1-5H3,(H,18,19) |
| InChIKey | RPGZGVXQDLMWPM-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.48 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|