C23H32OSi — CID 123543727
tert-butyl-[3-cyclopropyl-4-(2-phenylethyl)phenoxy]-dimethylsilane (PubChem CID 123543727) has the molecular formula C23H32OSi and a molecular weight of 352.59 g/mol. Its IUPAC name is tert-butyl-[3-cyclopropyl-4-(2-phenylethyl)phenoxy]-dimethylsilane.
| Compound Name | tert-butyl-[3-cyclopropyl-4-(2-phenylethyl)phenoxy]-dimethylsilane |
|---|---|
| PubChem CID | 123543727 |
| Molecular Formula | C23H32OSi |
| Molecular Weight | 352.59 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | tert-butyl-[3-cyclopropyl-4-(2-phenylethyl)phenoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(CCc2ccccc2)c(C2CC2)c1 |
| InChI | InChI=1S/C23H32OSi/c1-23(2,3)25(4,5)24-21-16-15-19(22(17-21)20-13-14-20)12-11-18-9-7-6-8-10-18/h6-10,15-17,20H,11-14H2,1-5H3 |
| InChIKey | WBAZVFZCBQXLRI-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.59 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|