C29H35NO3Si — CID 102154876
N-[4-[tert-butyl(dimethyl)silyl]oxy-2-(2-phenylacetyl)phenyl]-3-phenylpropanamide (PubChem CID 102154876) has the molecular formula C29H35NO3Si and a molecular weight of 473.69 g/mol. Its IUPAC name is N-[4-[tert-butyl(dimethyl)silyl]oxy-2-(2-phenylacetyl)phenyl]-3-phenylpropanamide.
| Compound Name | N-[4-[tert-butyl(dimethyl)silyl]oxy-2-(2-phenylacetyl)phenyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 102154876 |
| Molecular Formula | C29H35NO3Si |
| Molecular Weight | 473.69 g/mol |
| Exact Mass | 473.24 |
| IUPAC Name | N-[4-[tert-butyl(dimethyl)silyl]oxy-2-(2-phenylacetyl)phenyl]-3-phenylpropanamide |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(NC(=O)CCc2ccccc2)c(C(=O)Cc2ccccc2)c1 |
| InChI | InChI=1S/C29H35NO3Si/c1-29(2,3)34(4,5)33-24-17-18-26(30-28(32)19-16-22-12-8-6-9-13-22)25(21-24)27(31)20-23-14-10-7-11-15-23/h6-15,17-18,21H,16,19-20H2,1-5H3,(H,30,32) |
| InChIKey | JTSHXBHEFUCQQU-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.69 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|