C29H34N2OSi — CID 102154881
[4-benzyl-2-(2-phenylethyl)quinazolin-6-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 102154881) has the molecular formula C29H34N2OSi and a molecular weight of 454.69 g/mol. Its IUPAC name is [4-benzyl-2-(2-phenylethyl)quinazolin-6-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [4-benzyl-2-(2-phenylethyl)quinazolin-6-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 102154881 |
| Molecular Formula | C29H34N2OSi |
| Molecular Weight | 454.69 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | [4-benzyl-2-(2-phenylethyl)quinazolin-6-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc2nc(CCc3ccccc3)nc(Cc3ccccc3)c2c1 |
| InChI | InChI=1S/C29H34N2OSi/c1-29(2,3)33(4,5)32-24-17-18-26-25(21-24)27(20-23-14-10-7-11-15-23)31-28(30-26)19-16-22-12-8-6-9-13-22/h6-15,17-18,21H,16,19-20H2,1-5H3 |
| InChIKey | HSMDGTGVKLALMO-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.69 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|