C13H19IN2OSi — CID 66646911
tert-butyl-[(3-iodo-2H-indazol-5-yl)oxy]-dimethylsilane (PubChem CID 66646911) has the molecular formula C13H19IN2OSi and a molecular weight of 374.30 g/mol. Its IUPAC name is tert-butyl-[(3-iodo-2H-indazol-5-yl)oxy]-dimethylsilane.
| Compound Name | tert-butyl-[(3-iodo-2H-indazol-5-yl)oxy]-dimethylsilane |
|---|---|
| PubChem CID | 66646911 |
| Molecular Formula | C13H19IN2OSi |
| Molecular Weight | 374.30 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | tert-butyl-[(3-iodo-2H-indazol-5-yl)oxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc2n[nH]c(I)c2c1 |
| InChI | InChI=1S/C13H19IN2OSi/c1-13(2,3)18(4,5)17-9-6-7-11-10(8-9)12(14)16-15-11/h6-8H,1-5H3,(H,15,16) |
| InChIKey | VAYFASAXLKWTOV-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.30 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|