C17H26BNO2Si — CID 22966399
N-[7-[tert-butyl(dimethyl)silyl]oxynaphthalen-1-yl]-methylboronamidic acid (PubChem CID 22966399) has the molecular formula C17H26BNO2Si and a molecular weight of 315.30 g/mol. Its IUPAC name is N-[7-[tert-butyl(dimethyl)silyl]oxynaphthalen-1-yl]-methylboronamidic acid.
| Compound Name | N-[7-[tert-butyl(dimethyl)silyl]oxynaphthalen-1-yl]-methylboronamidic acid |
|---|---|
| PubChem CID | 22966399 |
| Molecular Formula | C17H26BNO2Si |
| Molecular Weight | 315.30 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | N-[7-[tert-butyl(dimethyl)silyl]oxynaphthalen-1-yl]-methylboronamidic acid |
| SMILES | CB(O)Nc1cccc2ccc(O[Si](C)(C)C(C)(C)C)cc12 |
| InChI | InChI=1S/C17H26BNO2Si/c1-17(2,3)22(5,6)21-14-11-10-13-8-7-9-16(15(13)12-14)19-18(4)20/h7-12,19-20H,1-6H3 |
| InChIKey | HKMNOBJZYHCOBH-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.30 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|