C25H38N2O4SSi — CID 18433593
tert-butyl N-[1-[[7-[tert-butyl(dimethyl)silyl]oxynaphthalen-1-yl]amino]-1-oxo-4-sulfanylbutan-2-yl]carbamate (PubChem CID 18433593) has the molecular formula C25H38N2O4SSi and a molecular weight of 490.74 g/mol. Its IUPAC name is tert-butyl N-[1-[[7-[tert-butyl(dimethyl)silyl]oxynaphthalen-1-yl]amino]-1-oxo-4-sulfanylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[7-[tert-butyl(dimethyl)silyl]oxynaphthalen-1-yl]amino]-1-oxo-4-sulfanylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 18433593 |
| Molecular Formula | C25H38N2O4SSi |
| Molecular Weight | 490.74 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | tert-butyl N-[1-[[7-[tert-butyl(dimethyl)silyl]oxynaphthalen-1-yl]amino]-1-oxo-4-sulfanylbutan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CCS)C(=O)Nc1cccc2ccc(O[Si](C)(C)C(C)(C)C)cc12 |
| InChI | InChI=1S/C25H38N2O4SSi/c1-24(2,3)30-23(29)27-21(14-15-32)22(28)26-20-11-9-10-17-12-13-18(16-19(17)20)31-33(7,8)25(4,5)6/h9-13,16,21,32H,14-15H2,1-8H3,(H,26,28)(H,27,29) |
| InChIKey | HMYAWLLWHQDUGS-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.74 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|