C24H37N3O5Si — CID 18433610
tert-butyl N-[1-[[3-[tert-butyl(dimethyl)silyl]oxyquinolin-5-yl]amino]-4-hydroxy-1-oxobutan-2-yl]carbamate (PubChem CID 18433610) has the molecular formula C24H37N3O5Si and a molecular weight of 475.66 g/mol. Its IUPAC name is tert-butyl N-[1-[[3-[tert-butyl(dimethyl)silyl]oxyquinolin-5-yl]amino]-4-hydroxy-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[3-[tert-butyl(dimethyl)silyl]oxyquinolin-5-yl]amino]-4-hydroxy-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 18433610 |
| Molecular Formula | C24H37N3O5Si |
| Molecular Weight | 475.66 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | tert-butyl N-[1-[[3-[tert-butyl(dimethyl)silyl]oxyquinolin-5-yl]amino]-4-hydroxy-1-oxobutan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CCO)C(=O)Nc1cccc2ncc(O[Si](C)(C)C(C)(C)C)cc12 |
| InChI | InChI=1S/C24H37N3O5Si/c1-23(2,3)31-22(30)27-20(12-13-28)21(29)26-19-11-9-10-18-17(19)14-16(15-25-18)32-33(7,8)24(4,5)6/h9-11,14-15,20,28H,12-13H2,1-8H3,(H,26,29)(H,27,30) |
| InChIKey | BGPMQDOTIHPQJG-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 109.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.66 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|