C30H41I4NO6Si — CID 174063870
tert-butyl (2S)-3-[4-[4-[tert-butyl(dimethyl)silyl]oxy-3,5-diiodophenoxy]-3,5-diiodophenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 174063870) has the molecular formula C30H41I4NO6Si and a molecular weight of 1047.36 g/mol. Its IUPAC name is tert-butyl (2S)-3-[4-[4-[tert-butyl(dimethyl)silyl]oxy-3,5-diiodophenoxy]-3,5-diiodophenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | tert-butyl (2S)-3-[4-[4-[tert-butyl(dimethyl)silyl]oxy-3,5-diiodophenoxy]-3,5-diiodophenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 174063870 |
| Molecular Formula | C30H41I4NO6Si |
| Molecular Weight | 1047.36 g/mol |
| Exact Mass | 1046.89 |
| IUPAC Name | tert-butyl (2S)-3-[4-[4-[tert-butyl(dimethyl)silyl]oxy-3,5-diiodophenoxy]-3,5-diiodophenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1cc(I)c(Oc2cc(I)c(O[Si](C)(C)C(C)(C)C)c(I)c2)c(I)c1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H41I4NO6Si/c1-28(2,3)39-26(36)23(35-27(37)40-29(4,5)6)14-17-12-19(31)24(20(32)13-17)38-18-15-21(33)25(22(34)16-18)41-42(10,11)30(7,8)9/h12-13,15-16,23H,14H2,1-11H3,(H,35,37)/t23-/m0/s1 |
| InChIKey | FWNSUZMDFMALKW-QHCPKHFHSA-N |
| XLogP | 10.06 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1047.36 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|