C15H23I2NO3Si — CID 167720105
(2S)-2-amino-3-[4-[tert-butyl(dimethyl)silyl]oxy-3,5-diiodophenyl]propanoic acid (PubChem CID 167720105) has the molecular formula C15H23I2NO3Si and a molecular weight of 547.25 g/mol. Its IUPAC name is (2S)-2-amino-3-[4-[tert-butyl(dimethyl)silyl]oxy-3,5-diiodophenyl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[4-[tert-butyl(dimethyl)silyl]oxy-3,5-diiodophenyl]propanoic acid |
|---|---|
| PubChem CID | 167720105 |
| Molecular Formula | C15H23I2NO3Si |
| Molecular Weight | 547.25 g/mol |
| Exact Mass | 546.95 |
| IUPAC Name | (2S)-2-amino-3-[4-[tert-butyl(dimethyl)silyl]oxy-3,5-diiodophenyl]propanoic acid |
| SMILES | CC(C)(C)[Si](C)(C)Oc1c(I)cc(C[C@H](N)C(=O)O)cc1I |
| InChI | InChI=1S/C15H23I2NO3Si/c1-15(2,3)22(4,5)21-13-10(16)6-9(7-11(13)17)8-12(18)14(19)20/h6-7,12H,8,18H2,1-5H3,(H,19,20)/t12-/m0/s1 |
| InChIKey | FAJFFTNJMUWRQW-LBPRGKRZSA-N |
| XLogP | 4.23 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.25 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|