C13H13I2NNa2O10S2 — CID 157182784
disodium;2-amino-3-[3,5-diiodo-4-(2-methanidylpropanoyloxy)phenyl]propanoic acid;bis(sulfur trioxide) (PubChem CID 157182784) has the molecular formula C13H13I2NNa2O10S2 and a molecular weight of 707.17 g/mol. Its IUPAC name is disodium;2-amino-3-[3,5-diiodo-4-(2-methanidylpropanoyloxy)phenyl]propanoic acid;bis(sulfur trioxide).
| Compound Name | disodium;2-amino-3-[3,5-diiodo-4-(2-methanidylpropanoyloxy)phenyl]propanoic acid;bis(sulfur trioxide) |
|---|---|
| PubChem CID | 157182784 |
| Molecular Formula | C13H13I2NNa2O10S2 |
| Molecular Weight | 707.17 g/mol |
| Exact Mass | 706.79 |
| IUPAC Name | disodium;2-amino-3-[3,5-diiodo-4-(2-methanidylpropanoyloxy)phenyl]propanoic acid;bis(sulfur trioxide) |
| SMILES | O=S(=O)=O.O=S(=O)=O.[CH2-]C([CH2-])C(=O)Oc1c(I)cc(CC(N)C(=O)O)cc1I.[Na+].[Na+] |
| InChI | InChI=1S/C13H13I2NO4.2Na.2O3S/c1-6(2)13(19)20-11-8(14)3-7(4-9(11)15)5-10(16)12(17)18;;;2*1-4(2)3/h3-4,6,10H,1-2,5,16H2,(H,17,18);;;;/q-2;2*+1;; |
| InChIKey | SLHKWSLMTMTPEH-UHFFFAOYSA-N |
| XLogP | -5.96 |
| TPSA | 192.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.17 |
| LogP ≤ 5 | -5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|