C9H8I2NO3- — CID 102445950
4-[(2S)-2-amino-2-carboxyethyl]-2,6-diiodophenolate (PubChem CID 102445950) has the molecular formula C9H8I2NO3- and a molecular weight of 431.98 g/mol. Its IUPAC name is 4-[(2S)-2-amino-2-carboxyethyl]-2,6-diiodophenolate.
| Compound Name | 4-[(2S)-2-amino-2-carboxyethyl]-2,6-diiodophenolate |
|---|---|
| PubChem CID | 102445950 |
| Molecular Formula | C9H8I2NO3- |
| Molecular Weight | 431.98 g/mol |
| Exact Mass | 431.86 |
| IUPAC Name | 4-[(2S)-2-amino-2-carboxyethyl]-2,6-diiodophenolate |
| SMILES | N[C@@H](Cc1cc(I)c([O-])c(I)c1)C(=O)O |
| InChI | InChI=1S/C9H9I2NO3/c10-5-1-4(2-6(11)8(5)13)3-7(12)9(14)15/h1-2,7,13H,3,12H2,(H,14,15)/p-1/t7-/m0/s1 |
| InChIKey | NYPYHUZRZVSYKL-ZETCQYMHSA-M |
| XLogP | 0.92 |
| TPSA | 86.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.98 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|