C16H13Cl2I2NO3 — CID 22035602
2-amino-3-[4-[(2,6-dichlorophenyl)methoxy]-3,5-diiodophenyl]propanoic acid (PubChem CID 22035602) has the molecular formula C16H13Cl2I2NO3 and a molecular weight of 592.00 g/mol. Its IUPAC name is 2-amino-3-[4-[(2,6-dichlorophenyl)methoxy]-3,5-diiodophenyl]propanoic acid.
| Compound Name | 2-amino-3-[4-[(2,6-dichlorophenyl)methoxy]-3,5-diiodophenyl]propanoic acid |
|---|---|
| PubChem CID | 22035602 |
| Molecular Formula | C16H13Cl2I2NO3 |
| Molecular Weight | 592.00 g/mol |
| Exact Mass | 590.84 |
| IUPAC Name | 2-amino-3-[4-[(2,6-dichlorophenyl)methoxy]-3,5-diiodophenyl]propanoic acid |
| SMILES | NC(Cc1cc(I)c(OCc2c(Cl)cccc2Cl)c(I)c1)C(=O)O |
| InChI | InChI=1S/C16H13Cl2I2NO3/c17-10-2-1-3-11(18)9(10)7-24-15-12(19)4-8(5-13(15)20)6-14(21)16(22)23/h1-5,14H,6-7,21H2,(H,22,23) |
| InChIKey | XAFBBHLJEQSWJF-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.00 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|