C21H30BN3O5 — CID 42637149
[6-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxo-7-(quinolin-3-ylamino)heptyl]boronic acid (PubChem CID 42637149) has the molecular formula C21H30BN3O5 and a molecular weight of 415.30 g/mol. Its IUPAC name is [6-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxo-7-(quinolin-3-ylamino)heptyl]boronic acid.
| Compound Name | [6-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxo-7-(quinolin-3-ylamino)heptyl]boronic acid |
|---|---|
| PubChem CID | 42637149 |
| Molecular Formula | C21H30BN3O5 |
| Molecular Weight | 415.30 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | [6-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxo-7-(quinolin-3-ylamino)heptyl]boronic acid |
| SMILES | CC(C)(C)OC(=O)NC(CCCCCB(O)O)C(=O)Nc1cnc2ccccc2c1 |
| InChI | InChI=1S/C21H30BN3O5/c1-21(2,3)30-20(27)25-18(11-5-4-8-12-22(28)29)19(26)24-16-13-15-9-6-7-10-17(15)23-14-16/h6-7,9-10,13-14,18,28-29H,4-5,8,11-12H2,1-3H3,(H,24,26)(H,25,27) |
| InChIKey | QAGGHXSLYHBTGS-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 120.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.30 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|