C18H23N3O3 — CID 142680437
N'-hydroxy-2-methyl-N-quinolin-3-yloctanediamide (PubChem CID 142680437) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is N'-hydroxy-2-methyl-N-quinolin-3-yloctanediamide.
| Compound Name | N'-hydroxy-2-methyl-N-quinolin-3-yloctanediamide |
|---|---|
| PubChem CID | 142680437 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | N'-hydroxy-2-methyl-N-quinolin-3-yloctanediamide |
| SMILES | CC(CCCCCC(=O)NO)C(=O)Nc1cnc2ccccc2c1 |
| InChI | InChI=1S/C18H23N3O3/c1-13(7-3-2-4-10-17(22)21-24)18(23)20-15-11-14-8-5-6-9-16(14)19-12-15/h5-6,8-9,11-13,24H,2-4,7,10H2,1H3,(H,20,23)(H,21,22) |
| InChIKey | HDKHXQLMZYYWNR-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|