C15H18N4O2 — CID 29330454
(2R)-2-(carbamoylamino)-3-methyl-N-quinolin-3-ylbutanamide (PubChem CID 29330454) has the molecular formula C15H18N4O2 and a molecular weight of 286.33 g/mol. Its IUPAC name is (2R)-2-(carbamoylamino)-3-methyl-N-quinolin-3-ylbutanamide.
| Compound Name | (2R)-2-(carbamoylamino)-3-methyl-N-quinolin-3-ylbutanamide |
|---|---|
| PubChem CID | 29330454 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | (2R)-2-(carbamoylamino)-3-methyl-N-quinolin-3-ylbutanamide |
| SMILES | CC(C)[C@@H](NC(N)=O)C(=O)Nc1cnc2ccccc2c1 |
| InChI | InChI=1S/C15H18N4O2/c1-9(2)13(19-15(16)21)14(20)18-11-7-10-5-3-4-6-12(10)17-8-11/h3-9,13H,1-2H3,(H,18,20)(H3,16,19,21)/t13-/m1/s1 |
| InChIKey | YYNQQTNHTKHBSW-CYBMUJFWSA-N |
| XLogP | 1.87 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |