C20H30N2O4S — CID 86726295
S-[(6S)-7-anilino-6-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxoheptyl] ethanethioate (PubChem CID 86726295) has the molecular formula C20H30N2O4S and a molecular weight of 394.54 g/mol. Its IUPAC name is S-[(6S)-7-anilino-6-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxoheptyl] ethanethioate.
| Compound Name | S-[(6S)-7-anilino-6-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxoheptyl] ethanethioate |
|---|---|
| PubChem CID | 86726295 |
| Molecular Formula | C20H30N2O4S |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | S-[(6S)-7-anilino-6-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxoheptyl] ethanethioate |
| SMILES | CC(=O)SCCCCC[C@H](NC(=O)OC(C)(C)C)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C20H30N2O4S/c1-15(23)27-14-10-6-9-13-17(22-19(25)26-20(2,3)4)18(24)21-16-11-7-5-8-12-16/h5,7-8,11-12,17H,6,9-10,13-14H2,1-4H3,(H,21,24)(H,22,25)/t17-/m0/s1 |
| InChIKey | FNBOMEOAOQLYIH-KRWDZBQOSA-N |
| XLogP | 4.36 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|