C21H35N3O5 — CID 158633457
acetic acid;tert-butyl N-[(2S)-6-amino-1-(4-ethylanilino)-1-oxohexan-2-yl]carbamate (PubChem CID 158633457) has the molecular formula C21H35N3O5 and a molecular weight of 409.53 g/mol. Its IUPAC name is acetic acid;tert-butyl N-[(2S)-6-amino-1-(4-ethylanilino)-1-oxohexan-2-yl]carbamate.
| Compound Name | acetic acid;tert-butyl N-[(2S)-6-amino-1-(4-ethylanilino)-1-oxohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 158633457 |
| Molecular Formula | C21H35N3O5 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.26 |
| IUPAC Name | acetic acid;tert-butyl N-[(2S)-6-amino-1-(4-ethylanilino)-1-oxohexan-2-yl]carbamate |
| SMILES | CC(=O)O.CCc1ccc(NC(=O)[C@H](CCCCN)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C19H31N3O3.C2H4O2/c1-5-14-9-11-15(12-10-14)21-17(23)16(8-6-7-13-20)22-18(24)25-19(2,3)4;1-2(3)4/h9-12,16H,5-8,13,20H2,1-4H3,(H,21,23)(H,22,24);1H3,(H,3,4)/t16-;/m0./s1 |
| InChIKey | CIFIGCVPIWXCEJ-NTISSMGPSA-N |
| XLogP | 3.30 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|