C23H36N4O5 — CID 153350095
tert-butyl N-[(5S)-5-[(2-amino-3-methylbut-2-enoyl)amino]-6-[4-(hydroxymethyl)anilino]-6-oxohexyl]carbamate (PubChem CID 153350095) has the molecular formula C23H36N4O5 and a molecular weight of 448.56 g/mol. Its IUPAC name is tert-butyl N-[(5S)-5-[(2-amino-3-methylbut-2-enoyl)amino]-6-[4-(hydroxymethyl)anilino]-6-oxohexyl]carbamate.
| Compound Name | tert-butyl N-[(5S)-5-[(2-amino-3-methylbut-2-enoyl)amino]-6-[4-(hydroxymethyl)anilino]-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 153350095 |
| Molecular Formula | C23H36N4O5 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.27 |
| IUPAC Name | tert-butyl N-[(5S)-5-[(2-amino-3-methylbut-2-enoyl)amino]-6-[4-(hydroxymethyl)anilino]-6-oxohexyl]carbamate |
| SMILES | CC(C)=C(N)C(=O)N[C@@H](CCCCNC(=O)OC(C)(C)C)C(=O)Nc1ccc(CO)cc1 |
| InChI | InChI=1S/C23H36N4O5/c1-15(2)19(24)21(30)27-18(8-6-7-13-25-22(31)32-23(3,4)5)20(29)26-17-11-9-16(14-28)10-12-17/h9-12,18,28H,6-8,13-14,24H2,1-5H3,(H,25,31)(H,26,29)(H,27,30)/t18-/m0/s1 |
| InChIKey | HSMKHZYBPFUMPU-SFHVURJKSA-N |
| XLogP | 2.55 |
| TPSA | 142.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|