C19H29N3O5 — CID 10309942
2-[4-[[(2S)-6-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]phenyl]acetic acid (PubChem CID 10309942) has the molecular formula C19H29N3O5 and a molecular weight of 379.46 g/mol. Its IUPAC name is 2-[4-[[(2S)-6-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]phenyl]acetic acid.
| Compound Name | 2-[4-[[(2S)-6-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]phenyl]acetic acid |
|---|---|
| PubChem CID | 10309942 |
| Molecular Formula | C19H29N3O5 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | 2-[4-[[(2S)-6-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]phenyl]acetic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCCN)C(=O)Nc1ccc(CC(=O)O)cc1 |
| InChI | InChI=1S/C19H29N3O5/c1-19(2,3)27-18(26)22-15(6-4-5-11-20)17(25)21-14-9-7-13(8-10-14)12-16(23)24/h7-10,15H,4-6,11-12,20H2,1-3H3,(H,21,25)(H,22,26)(H,23,24)/t15-/m0/s1 |
| InChIKey | BSKRQEXMQHVOFI-HNNXBMFYSA-N |
| XLogP | 2.27 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|