C18H27N3O5 — CID 10522859
(4S)-5-[4-(dimethylamino)anilino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid (PubChem CID 10522859) has the molecular formula C18H27N3O5 and a molecular weight of 365.43 g/mol. Its IUPAC name is (4S)-5-[4-(dimethylamino)anilino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid.
| Compound Name | (4S)-5-[4-(dimethylamino)anilino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 10522859 |
| Molecular Formula | C18H27N3O5 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | (4S)-5-[4-(dimethylamino)anilino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid |
| SMILES | CN(C)c1ccc(NC(=O)[C@H](CCC(=O)O)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C18H27N3O5/c1-18(2,3)26-17(25)20-14(10-11-15(22)23)16(24)19-12-6-8-13(9-7-12)21(4)5/h6-9,14H,10-11H2,1-5H3,(H,19,24)(H,20,25)(H,22,23)/t14-/m0/s1 |
| InChIKey | RXXRMRADAYZGMV-AWEZNQCLSA-N |
| XLogP | 2.45 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|