About tert-butyl N-[6-amino-1-oxo-1-[(1-oxo-3-phenylpropan-2-yl)amino]hexan-2-yl]carbamate;methanamine
tert-butyl N-[6-amino-1-oxo-1-[(1-oxo-3-phenylpropan-2-yl)amino]hexan-2-yl]carbamate;methanamine (PubChem CID 144982934) has the molecular formula C21H36N4O4
and a molecular weight of 408.54 g/mol. Its IUPAC name is tert-butyl N-[6-amino-1-oxo-1-[(1-oxo-3-phenylpropan-2-yl)amino]hexan-2-yl]carbamate;methanamine.
Molecular Properties
| Compound Name | tert-butyl N-[6-amino-1-oxo-1-[(1-oxo-3-phenylpropan-2-yl)amino]hexan-2-yl]carbamate;methanamine |
| PubChem CID | 144982934 |
| Molecular Formula | C21H36N4O4 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.27 |
| IUPAC Name | tert-butyl N-[6-amino-1-oxo-1-[(1-oxo-3-phenylpropan-2-yl)amino]hexan-2-yl]carbamate;methanamine |
| SMILES | CC(C)(C)OC(=O)NC(CCCCN)C(=O)NC(C=O)Cc1ccccc1.CN |
| InChI | InChI=1S/C20H31N3O4.CH5N/c1-20(2,3)27-19(26)23-17(11-7-8-12-21)18(25)22-16(14-24)13-15-9-5-4-6-10-15;1-2/h4-6,9-10,14,16-17H,7-8,11-13,21H2,1-3H3,(H,22,25)(H,23,26);2H2,1H3 |
| InChIKey | AUYGYAWJXKRRMF-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 136.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[6-amino-1-oxo-1-[(1-oxo-3-phenylpropan-2-yl)amino]hexan-2-yl]carbamate;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[6-amino-1-oxo-1-[(1-oxo-3-phenylpropan-2-yl)amino]hexan-2-yl]carbamate;methanamine?
The IUPAC name of tert-butyl N-[6-amino-1-oxo-1-[(1-oxo-3-phenylpropan-2-yl)amino]hexan-2-yl]carbamate;methanamine (CID 144982934) is tert-butyl N-[6-amino-1-oxo-1-[(1-oxo-3-phenylpropan-2-yl)amino]hexan-2-yl]carbamate;methanamine.
What is the SMILES notation for tert-butyl N-[6-amino-1-oxo-1-[(1-oxo-3-phenylpropan-2-yl)amino]hexan-2-yl]carbamate;methanamine?
The canonical SMILES for tert-butyl N-[6-amino-1-oxo-1-[(1-oxo-3-phenylpropan-2-yl)amino]hexan-2-yl]carbamate;methanamine is CC(C)(C)OC(=O)NC(CCCCN)C(=O)NC(C=O)Cc1ccccc1.CN.
What is the InChIKey of tert-butyl N-[6-amino-1-oxo-1-[(1-oxo-3-phenylpropan-2-yl)amino]hexan-2-yl]carbamate;methanamine?
The InChIKey is AUYGYAWJXKRRMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H31N3O4.CH5N/c1-20(2,3)27-19(26)23-17(11-7-8-12-21)18(25)22-16(14-24)13-15-9-5-4-6-10-15;1-2/h4-6,9-10,14,16-17H,7-8,11-13,21H2,1-3H3,(H,22,25)(H,23,26);2H2,1H3.
What are the key properties of tert-butyl N-[6-amino-1-oxo-1-[(1-oxo-3-phenylpropan-2-yl)amino]hexan-2-yl]carbamate;methanamine?
tert-butyl N-[6-amino-1-oxo-1-[(1-oxo-3-phenylpropan-2-yl)amino]hexan-2-yl]carbamate;methanamine has a molecular weight of 408.54 g/mol, XLogP of 1.51, 10 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[6-amino-1-oxo-1-[(1-oxo-3-phenylpropan-2-yl)amino]hexan-2-yl]carbamate;methanamine is sourced from PubChem (CID 144982934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).